CAS 1286208-66-9

1,1-Dimethylethyl N-[(3S)-1-[(2-chlorophenyl)methyl]-3-pyrrolidinyl]carbamate

Description:

1,1-Dimethylethyl N-[(3S)-1-[(2-chlorophenyl)methyl]-3-pyrrolidinyl]carbamate, identified by its CAS number 1286208-66-9, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by a dimethyl group attached to a tert-butyl moiety, which contributes to its steric properties. The presence of a pyrrolidine ring indicates potential for biological activity, as pyrrolidine derivatives are often associated with various pharmacological effects. The 2-chlorophenyl group suggests that the compound may exhibit specific interactions with biological targets, potentially influencing its efficacy and selectivity. Additionally, the stereochemistry indicated by the (3S) configuration may play a crucial role in the compound's biological activity, as stereoisomers can exhibit significantly different properties. Overall, this compound's unique structure may render it of interest in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₆H₂₃ClN₂O₂

InChI: InChI=1S/C16H23ClN2O2/c1-16(2,3)21-15(20)18-13-8-9-19(11-13)10-12-6-4-5-7-14(12)17/h4-7,13H,8-11H2,1-3H3,(H,18,20)/t13-/m0/s1

InChI key: InChIKey=VMBMRJCGCMAPDV-ZDUSSCGKSA-N

SMILES: C(N1C[C@@H](NC(OC(C)(C)C)=O)CC1)C2=C(Cl)C=CC=C2

Synonyms:

• Carbamic acid, N-[(3S)-1-[(2-chlorophenyl)methyl]-3-pyrrolidinyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[(3S)-1-[(2-chlorophenyl)methyl]-3-pyrrolidinyl]carbamate

(S)-tert-Butyl 1-(2-chlorobenzyl)pyrrolidin-3-ylcarbamate

CAS: 1286208-66-9

Formula: C₁₆H₂₃ClN₂O₂

Purity: 95.0%

Molecular weight: 310.82

Ref: 10-F064168