CAS 1286208-67-0

Methanone, (4-amino-1-piperidinyl)[(2S)-tetrahydro-2-furanyl]-, hydrochloride (1:1)

Description:

Methanone, (4-amino-1-piperidinyl)[(2S)-tetrahydro-2-furanyl]-, hydrochloride (1:1), identified by CAS number 1286208-67-0, is a chemical compound characterized by its complex structure that includes a piperidine ring and a tetrahydrofuran moiety. This compound features an amino group, which contributes to its potential as a pharmacological agent. The hydrochloride salt form indicates that it is a hydrochloride, enhancing its solubility in water and stability, which is often desirable for pharmaceutical applications. The presence of the tetrahydrofuran ring suggests that it may exhibit unique reactivity and interaction properties, potentially influencing its biological activity. As a hydrochloride, it is likely to be a white crystalline solid, commonly used in research and development within medicinal chemistry. Its specific characteristics, such as melting point, solubility, and biological activity, would depend on detailed experimental data, which is essential for understanding its potential applications in drug development or other chemical processes.

Formula: C₁₀H₁₈N₂O₂·ClH

InChI: InChI=1S/C10H18N2O2.ClH/c11-8-3-5-12(6-4-8)10(13)9-2-1-7-14-9;/h8-9H,1-7,11H2;1H/t9-;/m0./s1

InChI key: InChIKey=GPCHGFSZHMBEMG-FVGYRXGTSA-N

SMILES: C(=O)(N1CCC(N)CC1)[C@@H]2CCCO2.Cl

Synonyms:

• Methanone, (4-amino-1-piperidinyl)[(2S)-tetrahydro-2-furanyl]-, hydrochloride (1:1)

(S)-(4-Aminopiperidin-1-yl)(tetrahydrofuran-2-yl)methanone hydrochloride

CAS: 1286208-67-0

Formula: C₁₀H₁₉ClN₂O₂

Purity: 95.0%

Molecular weight: 234.72

Ref: 10-F064299