CAS 1286208-73-8

3-Pyrrolidinamine, 1-[(4-bromophenyl)methyl]-, hydrochloride (1:2), (3R)-

Description:

3-Pyrrolidinamine, 1-[(4-bromophenyl)methyl]-, hydrochloride (1:2), (3R)- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a bromophenyl group indicates that it has a bromine atom substituted on a phenyl ring, contributing to its potential biological activity and lipophilicity. The hydrochloride form suggests that the compound is a salt, which typically enhances its solubility in water and may influence its pharmacokinetic properties. The (3R)- designation indicates that the compound has a specific stereochemistry at the third carbon of the pyrrolidine ring, which can be crucial for its interaction with biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with various biological pathways. As with many such compounds, its safety, efficacy, and potential applications would require thorough investigation through experimental studies.

Formula: C₁₁H₁₅BrN₂.2ClH

InChI: InChI=1S/C11H15BrN2.2ClH/c12-10-3-1-9(2-4-10)7-14-6-5-11(13)8-14;;/h1-4,11H,5-8,13H2;2*1H/t11-;;/m1../s1

InChI key: InChIKey=JIXOPTKQXMLVRF-NVJADKKVSA-N

SMILES: C(N1C[C@H](N)CC1)C2=CC=C(Br)C=C2.Cl

(R)-1-(4-Bromobenzyl)pyrrolidin-3-aminedihydrochloride

CAS: 1286208-73-8

Formula: C₁₁H₁₇BrCl₂N₂

Purity: 95.0%

Molecular weight: 328.08

Ref: 10-F064251