CAS 1286208-75-0

1,1-Dimethylethyl N-[(3R)-1-(2-ethyl-1-oxobutyl)-3-pyrrolidinyl]carbamate

Description:

1,1-Dimethylethyl N-[(3R)-1-(2-ethyl-1-oxobutyl)-3-pyrrolidinyl]carbamate, with the CAS number 1286208-75-0, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by a dimethyl group attached to a tert-butyl moiety, which contributes to its steric bulk. The presence of a pyrrolidine ring indicates potential biological activity, as pyrrolidine derivatives are often associated with various pharmacological properties. The compound also contains an oxobutyl side chain, which may influence its solubility and reactivity. In terms of physical properties, carbamates typically exhibit moderate to high polarity, affecting their interactions in biological systems. The specific stereochemistry at the 3R position suggests that the compound may exhibit chirality, which can significantly impact its biological activity and interactions with enzymes or receptors. Overall, this compound's unique structural features may render it of interest in medicinal chemistry and drug development, although detailed studies would be necessary to elucidate its specific properties and potential applications.

Formula: C₁₅H₂₈N₂O₃

InChI: InChI=1S/C15H28N2O3/c1-6-11(7-2)13(18)17-9-8-12(10-17)16-14(19)20-15(3,4)5/h11-12H,6-10H2,1-5H3,(H,16,19)/t12-/m1/s1

InChI key: InChIKey=OPJCHPYRQZORKN-GFCCVEGCSA-N

SMILES: C(C(CC)CC)(=O)N1C[C@H](NC(OC(C)(C)C)=O)CC1

Synonyms:

• 1,1-Dimethylethyl N-[(3R)-1-(2-ethyl-1-oxobutyl)-3-pyrrolidinyl]carbamate
• Carbamic acid, N-[(3R)-1-(2-ethyl-1-oxobutyl)-3-pyrrolidinyl]-, 1,1-dimethylethyl ester
• tert-Butyl N-[(3R)-1-(2-ethylbutanoyl)pyrrolidin-3-yl]carbamate

(R)-tert-Butyl 1-(2-ethylbutanoyl)pyrrolidin-3-ylcarbamate

CAS: 1286208-75-0

Formula: C₁₅H₂₈N₂O₃

Purity: 95.0%

Molecular weight: 284.4

Ref: 10-F064266