CymitQuimica logo

CAS 1286208-97-6

:

3-Pyrrolidinamine, 1-ethyl-, hydrochloride (1:2), (3R)-

Description:
3-Pyrrolidinamine, 1-ethyl-, hydrochloride (1:2), (3R)- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features an ethyl group attached to the nitrogen atom of the pyrrolidine, contributing to its amine properties. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and research. The (3R) designation indicates the specific stereochemistry of the molecule, which can influence its biological activity and interaction with receptors. Generally, compounds of this nature may exhibit properties such as being a potential intermediate in organic synthesis or having implications in medicinal chemistry, particularly in the development of drugs targeting the central nervous system. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C6H14N2·2ClH
InChI:InChI=1S/C6H14N2.2ClH/c1-2-8-4-3-6(7)5-8;;/h6H,2-5,7H2,1H3;2*1H/t6-;;/m1../s1
InChI key:InChIKey=MEPWCWGVVOIHJR-QYCVXMPOSA-N
SMILES:C(C)N1C[C@H](N)CC1.Cl
Synonyms:
  • 3-Pyrrolidinamine, 1-ethyl-, hydrochloride (1:2), (3R)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.