CAS 1286209-03-7

3-Pyrrolidinamine, 1-(2,2-dimethylpropyl)-, hydrochloride (1:2), (3R)-

Description:

3-Pyrrolidinamine, 1-(2,2-dimethylpropyl)-, hydrochloride (1:2), (3R)- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The compound features a substituent at the nitrogen atom, specifically a 2,2-dimethylpropyl group, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in various fields, including pharmaceuticals. The (3R)- designation indicates the specific stereochemistry of the molecule, which can significantly influence its biological activity and interaction with receptors. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which are important for its reactivity and interaction with other molecules. Its specific applications and effects would depend on further research, particularly in the context of medicinal chemistry and potential therapeutic uses.

Formula: C₉H₂₀N₂·2ClH

InChI: InChI=1S/C9H20N2.2ClH/c1-9(2,3)7-11-5-4-8(10)6-11;;/h8H,4-7,10H2,1-3H3;2*1H/t8-;;/m1../s1

InChI key: InChIKey=MSDNGHRQXWSGCF-YCBDHFTFSA-N

SMILES: C(C(C)(C)C)N1CC[C@@H](N)C1.Cl

Synonyms:

• 3-Pyrrolidinamine, 1-(2,2-dimethylpropyl)-, hydrochloride (1:2), (3R)-

(R)-1-Neopentylpyrrolidin-3-amine dihydrochloride

CAS: 1286209-03-7

Formula: C₉H₂₂Cl₂N₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 229.19

Ref: 10-F064243