CAS 1286209-04-8

1,1-Dimethylethyl N-[(3S)-1-[(2-methoxyphenyl)methyl]-3-pyrrolidinyl]carbamate

Description:

1,1-Dimethylethyl N-[(3S)-1-[(2-methoxyphenyl)methyl]-3-pyrrolidinyl]carbamate, identified by its CAS number 1286209-04-8, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by a dimethyl group attached to a tert-butyl moiety, which contributes to its steric bulk. The presence of a pyrrolidine ring indicates potential for biological activity, as pyrrolidine derivatives are often associated with various pharmacological effects. The methoxyphenyl group enhances lipophilicity, potentially influencing the compound's solubility and permeability in biological systems. As a carbamate, it may exhibit properties typical of this class, such as inhibition of acetylcholinesterase, although specific biological activities would depend on the overall molecular configuration and substituents. The compound's stereochemistry, particularly the (3S) configuration, suggests that it may exhibit chiral properties, which can affect its interaction with biological targets. Overall, this compound's unique structure positions it as a candidate for further investigation in medicinal chemistry and pharmacology.

Formula: C₁₇H₂₆N₂O₃

InChI: InChI=1S/C17H26N2O3/c1-17(2,3)22-16(20)18-14-9-10-19(12-14)11-13-7-5-6-8-15(13)21-4/h5-8,14H,9-12H2,1-4H3,(H,18,20)/t14-/m0/s1

InChI key: InChIKey=JUSOQPBZYMQCSL-AWEZNQCLSA-N

SMILES: C(C1=C(OC)C=CC=C1)N2C[C@@H](NC(OC(C)(C)C)=O)CC2

Synonyms:

• Carbamic acid, N-[(3S)-1-[(2-methoxyphenyl)methyl]-3-pyrrolidinyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[(3S)-1-[(2-methoxyphenyl)methyl]-3-pyrrolidinyl]carbamate

(S)-tert-Butyl 1-(2-methoxybenzyl)pyrrolidin-3-ylcarbamate

CAS: 1286209-04-8

Formula: C₁₇H₂₆N₂O₃

Purity: 95.0%

Molecular weight: 306.406

Ref: 10-F064302