CAS 1286209-08-2

3-Piperidinamine, N-[(3-bromophenyl)methyl]-, hydrochloride (1:2), (3R)-

Description:

3-Piperidinamine, N-[(3-bromophenyl)methyl]-, hydrochloride (1:2), (3R)- is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a bromophenyl group indicates that a bromine atom is substituted on the phenyl ring, contributing to the compound's potential biological activity. The hydrochloride salt form suggests that the compound is a protonated amine, enhancing its solubility in water and making it suitable for various applications, including pharmaceutical formulations. The (3R)- designation indicates the specific stereochemistry at the piperidine nitrogen, which can influence the compound's interaction with biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions, given the structural features common in psychoactive substances. As with many amines, it may also participate in hydrogen bonding, affecting its reactivity and interaction with other molecules. Safety and handling precautions should be observed due to the presence of bromine and the potential for biological activity.

Formula: C₁₂H₁₇BrN₂·2ClH

InChI: InChI=1S/C12H17BrN2.2ClH/c13-11-4-1-3-10(7-11)8-15-12-5-2-6-14-9-12;;/h1,3-4,7,12,14-15H,2,5-6,8-9H2;2*1H/t12-;;/m1../s1

InChI key: InChIKey=MFBVYIRHVJKRLN-CURYUGHLSA-N

SMILES: C(N[C@@H]1CCCNC1)C2=CC(Br)=CC=C2.Cl

Synonyms:

• 3-Piperidinamine, N-[(3-bromophenyl)methyl]-, hydrochloride (1:2), (3R)-

(R)-N-[(3-Bromophenyl)methyl]piperidin-3-amine dihydrochloride

CAS: 1286209-08-2

Formula: C₁₂H₁₉BrCl₂N₂

Purity: 95.0%

Molecular weight: 342.1

Ref: 10-F064421