CAS 1286209-09-3

1,1-Dimethylethyl (3S)-3-[(cyclopropylcarbonyl)amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl (3S)-3-[(cyclopropylcarbonyl)amino]-1-piperidinecarboxylate, with the CAS number 1286209-09-3, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a cyclopropylcarbonyl group. This compound features a dimethyl substituent on the carbon adjacent to the piperidine nitrogen, contributing to its steric properties. The presence of the cyclopropylcarbonyl moiety suggests potential reactivity and interactions typical of amides, which may influence its biological activity. The stereochemistry indicated by the (3S) designation implies a specific spatial arrangement of atoms, which can significantly affect the compound's pharmacological properties. As a piperidine derivative, it may exhibit various biological activities, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity would depend on the functional groups present and the overall molecular conformation. Further studies would be necessary to elucidate its specific applications and interactions in biological systems.

Formula: C₁₄H₂₄N₂O₃

InChI: InChI=1S/C14H24N2O3/c1-14(2,3)19-13(18)16-8-4-5-11(9-16)15-12(17)10-6-7-10/h10-11H,4-9H2,1-3H3,(H,15,17)/t11-/m0/s1

InChI key: InChIKey=DJLFKWRLNWWOGT-NSHDSACASA-N

SMILES: N(C(=O)C1CC1)[C@@H]2CN(C(OC(C)(C)C)=O)CCC2

Synonyms:

• 1-Piperidinecarboxylic acid, 3-[(cyclopropylcarbonyl)amino]-, 1,1-dimethylethyl ester, (3S)-
• 1,1-Dimethylethyl (3S)-3-[(cyclopropylcarbonyl)amino]-1-piperidinecarboxylate

(S)-tert-Butyl 3-cyclopropaneamidopiperidine-1-carboxylate

CAS: 1286209-09-3

Formula: C₁₄H₂₄N₂O₃

Purity: 95.0%

Molecular weight: 268.357

Ref: 10-F064428