CAS 1286209-19-5

1,1-Dimethylethyl N-[(3R)-1-(4-pyridinylcarbonyl)-3-pyrrolidinyl]carbamate

Description:

1,1-Dimethylethyl N-[(3R)-1-(4-pyridinylcarbonyl)-3-pyrrolidinyl]carbamate, with the CAS number 1286209-19-5, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a pyrrolidine ring. This compound is typically classified as a pharmaceutical intermediate or a potential drug candidate, often investigated for its biological activity. The presence of the pyridine and pyrrolidine moieties suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure indicates that it may exhibit specific stereochemistry, which can influence its pharmacological properties. Additionally, the dimethyl group contributes to its steric properties, potentially affecting its solubility and reactivity. While specific physical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature often exhibit moderate to high lipophilicity, which can influence their bioavailability and distribution in biological systems. Overall, this compound represents a class of molecules that may have significant implications in drug development and therapeutic applications.

Formula: C₁₅H₂₁N₃O₃

InChI: InChI=1S/C15H21N3O3/c1-15(2,3)21-14(20)17-12-6-9-18(10-12)13(19)11-4-7-16-8-5-11/h4-5,7-8,12H,6,9-10H2,1-3H3,(H,17,20)/t12-/m1/s1

InChI key: InChIKey=ACVYQWRIYSTAMO-GFCCVEGCSA-N

SMILES: C(=O)(N1C[C@H](NC(OC(C)(C)C)=O)CC1)C=2C=CN=CC2

Synonyms:

• Carbamic acid, N-[(3R)-1-(4-pyridinylcarbonyl)-3-pyrrolidinyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[(3R)-1-(4-pyridinylcarbonyl)-3-pyrrolidinyl]carbamate

(S)-tert-Butyl 1-isonicotinoylpyrrolidin-3-ylcarbamate

CAS: 1286209-19-5

Formula: C₁₅H₂₁N₃O₃

Purity: 95.0%

Molecular weight: 291.351

Ref: 10-F064316