CAS 1286209-20-8

1-[(3R)-3-Amino-1-pyrrolidinyl]-2,2-dimethyl-1-propanone

Description:

1-[(3R)-3-Amino-1-pyrrolidinyl]-2,2-dimethyl-1-propanone, identified by its CAS number 1286209-20-8, is a chemical compound characterized by its unique structural features. It contains a pyrrolidine ring, which contributes to its potential biological activity, particularly in the context of pharmacology. The presence of an amino group enhances its ability to interact with biological systems, potentially influencing neurotransmitter pathways. This compound is classified as a ketone due to the presence of the carbonyl group (C=O) within its structure. Its dimethyl substitution on the propanone backbone may affect its steric properties and reactivity. The stereochemistry indicated by the (3R) configuration suggests specific spatial arrangements that can be crucial for its interaction with biological targets. Overall, this compound's characteristics, including its molecular structure and functional groups, suggest potential applications in medicinal chemistry, although further studies would be necessary to elucidate its specific properties and biological effects.

Formula: C₉H₁₈N₂O

InChI: InChI=1S/C9H18N2O/c1-9(2,3)8(12)11-5-4-7(10)6-11/h7H,4-6,10H2,1-3H3/t7-/m1/s1

InChI key: InChIKey=NPXQQVKSWPXMDX-SSDOTTSWSA-N

SMILES: C(C(C)(C)C)(=O)N1C[C@H](N)CC1

Synonyms:

• 1-[(3R)-3-Amino-1-pyrrolidinyl]-2,2-dimethyl-1-propanone
• 1-Propanone, 1-[(3R)-3-amino-1-pyrrolidinyl]-2,2-dimethyl-

(R)-1-(3-Aminopyrrolidin-1-yl)-2,2-dimethylpropan-1-one

CAS: 1286209-20-8

Formula: C₉H₁₈N₂O

Purity: 95.0%

Molecular weight: 170.256

Ref: 10-F064317