CAS 1286209-21-9

Propanamide, N-(3R)-3-piperidinyl-, hydrochloride (1:1)

Description:

Propanamide, N-(3R)-3-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and piperidine ring structure. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its bioavailability in pharmaceutical applications. The presence of the piperidine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit properties such as moderate to high polarity due to the amide and piperidine functionalities, influencing its behavior in various chemical environments. Additionally, the stereochemistry indicated by the (3R) designation suggests that the compound has specific spatial arrangements that could affect its pharmacological activity. Its CAS number, 1286209-21-9, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential applications in drug development. Overall, this compound's characteristics make it a subject of interest in research related to therapeutic agents.

Formula: C₈H₁₆N₂O·ClH

InChI: InChI=1S/C8H16N2O.ClH/c1-2-8(11)10-7-4-3-5-9-6-7;/h7,9H,2-6H2,1H3,(H,10,11);1H/t7-;/m1./s1

InChI key: InChIKey=KROJSRLGGQJBPS-OGFXRTJISA-N

SMILES: N(C(CC)=O)[C@@H]1CCCNC1.Cl

Synonyms:

• Propanamide, N-(3R)-3-piperidinyl-, hydrochloride (1:1)

(R)-N-(Piperidin-3-yl)propionamide hydrochloride

CAS: 1286209-21-9

Formula: C₈H₁₇ClN₂O

Purity: 95.0%

Molecular weight: 192.69

Ref: 10-F064368