CAS 1286209-22-0

Cyclobutanecarboxamide, N-(3R)-3-piperidinyl-, hydrochloride (1:1)

Description:

Cyclobutanecarboxamide, N-(3R)-3-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its specific structural features, including a cyclobutane ring and a piperidine moiety. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in aqueous solutions, making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the piperidine group suggests potential interactions with biological targets, possibly influencing its pharmacological properties. The compound's stereochemistry, indicated by the (3R) designation, implies that it has a specific three-dimensional arrangement that can affect its biological activity and interactions. As a carboxamide, it may exhibit hydrogen bonding capabilities, contributing to its stability and reactivity. Overall, this compound's unique structural characteristics and functional groups position it as a candidate for further research, particularly in medicinal chemistry, where understanding its behavior in biological systems is crucial for potential therapeutic applications.

Formula: C₁₀H₁₉ClN₂O

InChI: InChI=1S/C10H18N2O.ClH/c13-10(8-3-1-4-8)12-9-5-2-6-11-7-9;/h8-9,11H,1-7H2,(H,12,13);1H/t9-;/m1./s1

InChI key: InChIKey=ORBSPKZXYSOGDC-SBSPUUFOSA-N

SMILES: C(N[C@@H]1CCCNC1)(=O)C2CCC2.Cl

Synonyms:

• Cyclobutanecarboxamide, N-(3R)-3-piperidinyl-, hydrochloride (1:1)
• (R)-N-(Piperidin-3-yl)cyclobutanecarboxamide hydrochloride

(R)-N-(Piperidin-3-yl)cyclobutanecarboxamide hydrochloride

CAS: 1286209-22-0

Formula: C₁₀H₁₉ClN₂O

Purity: 95.0%

Molecular weight: 218.73

Ref: 10-F064376