CAS 1286209-31-1

1,1-Dimethylethyl (3R)-3-[(1-pyrrolidinylcarbonyl)amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl (3R)-3-[(1-pyrrolidinylcarbonyl)amino]-1-piperidinecarboxylate, with the CAS number 1286209-31-1, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a pyrrolidine moiety. This compound features a dimethyl group attached to a tertiary carbon, contributing to its steric bulk. The presence of the carbonyl and amino functional groups indicates potential for hydrogen bonding and reactivity, making it of interest in medicinal chemistry. The stereochemistry at the 3R position suggests specific spatial arrangements that can influence biological activity and interactions with receptors or enzymes. Its molecular properties, such as solubility and stability, would depend on the functional groups and overall structure, which can affect its pharmacokinetic and pharmacodynamic profiles. This compound may be explored for its potential therapeutic applications, particularly in areas related to neuropharmacology or as a building block in drug synthesis. Further studies would be necessary to elucidate its full biological activity and potential uses.

Formula: C₁₅H₂₇N₃O₃

InChI: InChI=1S/C15H27N3O3/c1-15(2,3)21-14(20)18-10-6-7-12(11-18)16-13(19)17-8-4-5-9-17/h12H,4-11H2,1-3H3,(H,16,19)/t12-/m1/s1

InChI key: InChIKey=VKTAHXZSOWMXQO-GFCCVEGCSA-N

SMILES: N(C(=O)N1CCCC1)[C@H]2CN(C(OC(C)(C)C)=O)CCC2

Synonyms:

• 1,1-Dimethylethyl (3R)-3-[(1-pyrrolidinylcarbonyl)amino]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3-[(1-pyrrolidinylcarbonyl)amino]-, 1,1-dimethylethyl ester, (3R)-

(R)-tert-Butyl 3-[(pyrrolidin-1-yl)carbonyl]aminopiperidine-1-carboxylate

CAS: 1286209-31-1

Formula: C₁₅H₂₇N₃O₃

Purity: 95.0%

Molecular weight: 297.399

Ref: 10-F064425