CAS 1286209-33-3

Pyrrolidine, 3-(2-fluoro-6-nitrophenoxy)-, hydrochloride (1:1), (3S)-

Description:

Pyrrolidine, 3-(2-fluoro-6-nitrophenoxy)-, hydrochloride (1:1), (3S)- is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a 2-fluoro-6-nitrophenoxy group indicates that the compound has both fluorine and nitro substituents on a phenyl ring, contributing to its potential reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in pharmaceutical applications. The (3S)- designation suggests that the compound has a specific stereochemistry at the pyrrolidine ring, which can influence its interaction with biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features. However, detailed information regarding its specific applications, toxicity, and pharmacological effects would require further investigation and analysis.

Formula: C₁₀H₁₁FN₂O₃·ClH

InChI: InChI=1S/C10H11FN2O3.ClH/c11-8-2-1-3-9(13(14)15)10(8)16-7-4-5-12-6-7;/h1-3,7,12H,4-6H2;1H/t7-;/m0./s1

InChI key: InChIKey=GZDMJISBKJVZFO-FJXQXJEOSA-N

SMILES: O(C1=C(N(=O)=O)C=CC=C1F)[C@H]2CCNC2.Cl

Synonyms:

• Pyrrolidine, 3-(2-fluoro-6-nitrophenoxy)-, hydrochloride (1:1), (3S)-

(S)-3-(2-Fluoro-6-nitrophenoxy)pyrrolidine hydrochloride

CAS: 1286209-33-3

Formula: C₁₀H₁₂ClFN₂O₃

Purity: 95.0%

Molecular weight: 262.67

Ref: 10-F063936