CAS 1286209-35-5

1,1-Dimethylethyl N-[(3S)-1-(1-oxopropyl)-3-pyrrolidinyl]carbamate

Description:

1,1-Dimethylethyl N-[(3S)-1-(1-oxopropyl)-3-pyrrolidinyl]carbamate, identified by its CAS number 1286209-35-5, is a chemical compound characterized by its unique structural features, including a carbamate functional group and a pyrrolidine ring. This compound typically exhibits moderate to high lipophilicity due to the presence of the tert-butyl group, which can influence its solubility and permeability in biological systems. The stereochemistry indicated by the (3S) configuration suggests that it may exhibit specific interactions with biological targets, potentially affecting its pharmacological properties. The presence of the oxopropyl moiety may also contribute to its reactivity and stability. In terms of safety and handling, like many carbamate derivatives, it may pose risks such as toxicity or environmental hazards, necessitating appropriate precautions during use. Overall, this compound's characteristics make it of interest in various fields, including medicinal chemistry and agrochemicals, where its biological activity and potential applications can be explored further.

Formula: C₁₂H₂₂N₂O₃

InChI: InChI=1S/C12H22N2O3/c1-5-10(15)14-7-6-9(8-14)13-11(16)17-12(2,3)4/h9H,5-8H2,1-4H3,(H,13,16)/t9-/m0/s1

InChI key: InChIKey=ZWSZUPSKOFVBGU-VIFPVBQESA-N

SMILES: N(C(OC(C)(C)C)=O)[C@@H]1CN(C(CC)=O)CC1

Synonyms:

• 1,1-Dimethylethyl N-[(3S)-1-(1-oxopropyl)-3-pyrrolidinyl]carbamate
• (S)-tert-Butyl 1-propionylpyrrolidin-3-ylcarbamate
• Carbamic acid, N-[(3S)-1-(1-oxopropyl)-3-pyrrolidinyl]-, 1,1-dimethylethyl ester

(S)-tert-Butyl 1-propionylpyrrolidin-3-ylcarbamate

CAS: 1286209-35-5

Formula: C₁₂H₂₂N₂O₃

Purity: 95.0%

Molecular weight: 242.319

Ref: 10-F063981