CAS 1286263-48-6

1,1-Dimethylethyl N-[trans-4-[(3,3-dimethyl-1-oxobutyl)amino]cyclohexyl]carbamate

Description:

1,1-Dimethylethyl N-[trans-4-[(3,3-dimethyl-1-oxobutyl)amino]cyclohexyl]carbamate, identified by its CAS number 1286263-48-6, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by a cyclohexyl group and a dimethylated side chain, which contributes to its unique properties. Typically, carbamates are known for their applications in agriculture as pesticides and herbicides, as well as in pharmaceuticals. The presence of the dimethyl and cyclohexyl groups may influence its solubility, stability, and biological activity. Additionally, the compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and its safety profile would need to be assessed through toxicological studies. Overall, this compound represents a specific example of how structural modifications can lead to diverse chemical behaviors and potential applications in various fields.

Formula: C₁₇H₃₂N₂O₃

InChI: InChI=1/C17H32N2O3/c1-16(2,3)11-14(20)18-12-7-9-13(10-8-12)19-15(21)22-17(4,5)6/h12-13H,7-11H2,1-6H3,(H,18,20)(H,19,21)/t12-,13-

InChI key: InChIKey=DAEMECXKQMKXCS-JOCQHMNTNA-N

SMILES: N(C(CC(C)(C)C)=O)[C@H]1CC[C@H](NC(OC(C)(C)C)=O)CC1

Synonyms:

• Carbamic acid, N-[trans-4-[(3,3-dimethyl-1-oxobutyl)amino]cyclohexyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[trans-4-[(3,3-dimethyl-1-oxobutyl)amino]cyclohexyl]carbamate

tert-Butyl (1R*,4R*)-4-(3,3-dimethylbutanamido)cyclohexylcarbamate

CAS: 1286263-48-6

Formula: C₁₇H₃₂N₂O₃

Molecular weight: 312.454

Ref: 10-F097553