CAS 1286263-50-0

Benzonitrile, 4-[(4-piperidinylamino)methyl]-, hydrochloride (1:2)

Description:

Benzonitrile, 4-[(4-piperidinylamino)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its structure, which includes a benzonitrile moiety and a piperidinyl group. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water. This compound typically exhibits properties such as being a white to off-white solid, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its piperidinyl group may contribute to its biological activity, potentially influencing interactions with biological targets. The compound's molecular structure suggests it may participate in hydrogen bonding due to the amino group, which can affect its reactivity and solubility. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound represents a specific class of organic compounds that may have significance in research and development within the pharmaceutical industry.

Formula: C₁₃H₁₇N₃·2ClH

InChI: InChI=1S/C13H17N3.2ClH/c14-9-11-1-3-12(4-2-11)10-16-13-5-7-15-8-6-13;;/h1-4,13,15-16H,5-8,10H2;2*1H

InChI key: InChIKey=NIAJRWZQYAFJEE-UHFFFAOYSA-N

SMILES: C(NC1CCNCC1)C2=CC=C(C#N)C=C2.Cl

Synonyms:

• Benzonitrile, 4-[(4-piperidinylamino)methyl]-, hydrochloride (1:2)

4-[(Piperidine-4-ylamino)methyl]benzonitrile dihydrochloride

CAS: 1286263-50-0

Formula: C₁₃H₁₉Cl₂N₃

Purity: 95.0%

Molecular weight: 288.22

Ref: 10-F064137