CAS 1286263-97-5: 1,1-Dimethylethyl N-[1-[(3-fluoro-5-methylphenyl)methyl]-4-piperidinyl]carbamate

Description:1,1-Dimethylethyl N-[1-[(3-fluoro-5-methylphenyl)methyl]-4-piperidinyl]carbamate, identified by its CAS number 1286263-97-5, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and a fluoro-substituted aromatic group. The presence of the dimethyl group contributes to its steric properties, potentially influencing its reactivity and interaction with biological targets. The compound is likely to exhibit specific pharmacological activities, given its structural components, which may include interactions with neurotransmitter systems or other biological pathways. Its solubility, stability, and potential toxicity would depend on the specific functional groups and their arrangement within the molecule. As with many synthetic organic compounds, safety data and handling precautions should be consulted to ensure proper usage in laboratory or industrial settings. Overall, this compound's unique structure suggests potential applications in medicinal chemistry or agrochemicals, warranting further investigation into its properties and effects.

Formula:C₁₈H₂₇FN₂O₂

InChI:InChI=1S/C18H27FN2O2/c1-13-9-14(11-15(19)10-13)12-21-7-5-16(6-8-21)20-17(22)23-18(2,3)4/h9-11,16H,5-8,12H2,1-4H3,(H,20,22)

InChI key:InChIKey=FRZKMQIHKDWXKA-UHFFFAOYSA-N

SMILES:O=C(OC(C)(C)C)NC1CCN(CC=2C=C(F)C=C(C2)C)CC1

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	Tert-Butyl 1-(3-fluoro-5-methylbenzyl)piperidin-4-ylcarbamate REF: 10-F064122CAS: 1286263-97-5	95.0%	To inquire	Wed 23 Apr 25
	tert-Butyl 1-(3-fluoro-5-methylbenzyl)piperidin-4-ylcarbamate REF: 3D-LBC26397CAS: 1286263-97-5	Min. 95%	- - -	Discontinued product