CAS 1286264-07-0

1,1-Dimethylethyl N-[trans-4-[(1-oxopropyl)amino]cyclohexyl]carbamate

Description:

1,1-Dimethylethyl N-[trans-4-[(1-oxopropyl)amino]cyclohexyl]carbamate, identified by its CAS number 1286264-07-0, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by the presence of a dimethyl group, a cyclohexyl ring, and an amine functional group, which contribute to its unique chemical properties. The compound is likely to exhibit moderate to high lipophilicity due to the presence of hydrophobic groups, which may influence its solubility in organic solvents. Additionally, the presence of the carbamate functional group suggests potential reactivity, particularly in biological systems, where it may interact with enzymes or receptors. Its specific applications and biological activity would depend on its molecular interactions, making it of interest in pharmaceutical research and development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or environmental impact. Further studies would be necessary to fully elucidate its characteristics and potential uses.

Formula: C₁₄H₂₆N₂O₃

InChI: InChI=1/C14H26N2O3/c1-5-12(17)15-10-6-8-11(9-7-10)16-13(18)19-14(2,3)4/h10-11H,5-9H2,1-4H3,(H,15,17)(H,16,18)/t10-,11-

InChI key: InChIKey=HNAVLAPTQLAOBW-XYPYZODXNA-N

SMILES: N(C(OC(C)(C)C)=O)[C@H]1CC[C@H](NC(CC)=O)CC1

Synonyms:

• 1,1-Dimethylethyl N-[trans-4-[(1-oxopropyl)amino]cyclohexyl]carbamate
• Carbamic acid, N-[trans-4-[(1-oxopropyl)amino]cyclohexyl]-, 1,1-dimethylethyl ester

tert-Butyl (1R*,4R*)-4-propionamidocyclohexylcarbamate

CAS: 1286264-07-0

Formula: C₁₄H₂₆N₂O₃

Molecular weight: 270.373

Ref: 10-F097557