CAS 1286264-48-9

1,1-Dimethylethyl N-[[1-[(1-methylethyl)sulfonyl]-4-piperidinyl]methyl]carbamate

Description:

1,1-Dimethylethyl N-[[1-[(1-methylethyl)sulfonyl]-4-piperidinyl]methyl]carbamate, identified by its CAS number 1286264-48-9, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure that includes a piperidine ring, a sulfonyl group, and a tert-butyl moiety, contributing to its unique properties. It is typically characterized by its moderate to high solubility in organic solvents, while its solubility in water may vary depending on the specific formulation. The compound is often studied for its potential applications in pharmaceuticals, particularly as an active ingredient in pest control or as a therapeutic agent. Its mechanism of action may involve interactions with specific biological targets, making it of interest in medicinal chemistry. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or environmental impact. Overall, this compound exemplifies the complexity and diversity of modern chemical entities used in various applications.

Formula: C₁₄H₂₈N₂O₄S

InChI: InChI=1S/C14H28N2O4S/c1-11(2)21(18,19)16-8-6-12(7-9-16)10-15-13(17)20-14(3,4)5/h11-12H,6-10H2,1-5H3,(H,15,17)

InChI key: InChIKey=ZKBOQXUEENKZQY-UHFFFAOYSA-N

SMILES: S(C(C)C)(=O)(=O)N1CCC(CNC(OC(C)(C)C)=O)CC1

Synonyms:

• 1,1-Dimethylethyl N-[[1-[(1-methylethyl)sulfonyl]-4-piperidinyl]methyl]carbamate
• Carbamic acid, N-[[1-[(1-methylethyl)sulfonyl]-4-piperidinyl]methyl]-, 1,1-dimethylethyl ester

tert-Butyl [1-(isopropylsulfonyl)piperidin-4-yl]methylcarbamate

CAS: 1286264-48-9

Formula: C₁₄H₂₈N₂O₄S

Purity: 95.0%

Molecular weight: 320.45

Ref: 10-F064362