CAS 1286264-55-8

1,1-Dimethylethyl 4-[[[3-(methoxycarbonyl)phenyl]methyl]amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[[[3-(methoxycarbonyl)phenyl]methyl]amino]-1-piperidinecarboxylate, identified by its CAS number 1286264-55-8, is a chemical compound characterized by its complex structure, which includes a piperidine ring and various functional groups such as a methoxycarbonyl group and a tert-butyl group. This compound typically exhibits properties associated with both amines and esters, which may influence its solubility, reactivity, and potential biological activity. The presence of the methoxycarbonyl group suggests it may participate in esterification or hydrolysis reactions, while the piperidine moiety could contribute to its pharmacological properties. Such compounds are often investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or detailed literature references for precise values. Overall, this compound represents a class of organic molecules that may have significant implications in chemical synthesis and drug development.

Formula: C₁₉H₂₈N₂O₄

InChI: InChI=1S/C19H28N2O4/c1-19(2,3)25-18(23)21-10-8-16(9-11-21)20-13-14-6-5-7-15(12-14)17(22)24-4/h5-7,12,16,20H,8-11,13H2,1-4H3

InChI key: InChIKey=CHJFXSUZKIBDOS-UHFFFAOYSA-N

SMILES: C(NC1CCN(C(OC(C)(C)C)=O)CC1)C2=CC(C(OC)=O)=CC=C2

Synonyms:

• 1,1-Dimethylethyl 4-[[[3-(methoxycarbonyl)phenyl]methyl]amino]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 4-[[[3-(methoxycarbonyl)phenyl]methyl]amino]-, 1,1-dimethylethyl ester

tert-Butyl 4-[3-(methoxycarbonyl)benzylamino]piperidine-1-carboxylate

CAS: 1286264-55-8

Formula: C₁₉H₂₈N₂O₄

Purity: 95.0%

Molecular weight: 348.443

Ref: 10-F063783