CAS 1286264-73-0

1,1-Dimethylethyl N-[1-(2-fluorobenzoyl)-4-piperidinyl]carbamate

Description:

1,1-Dimethylethyl N-[1-(2-fluorobenzoyl)-4-piperidinyl]carbamate, identified by its CAS number 1286264-73-0, is a chemical compound characterized by its unique structural features, which include a carbamate functional group and a piperidine ring. This compound typically exhibits properties associated with both lipophilicity and moderate polarity due to the presence of the fluorobenzoyl moiety and the piperidine nitrogen. It may demonstrate biological activity, potentially acting as a pharmacological agent, although specific biological properties would depend on its interactions at the molecular level. The presence of the fluorine atom can enhance the compound's metabolic stability and influence its binding affinity to biological targets. Additionally, the dimethyl group contributes to steric hindrance, which may affect the compound's reactivity and solubility. Overall, this compound's characteristics suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₇H₂₃FN₂O₃

InChI: InChI=1S/C17H23FN2O3/c1-17(2,3)23-16(22)19-12-8-10-20(11-9-12)15(21)13-6-4-5-7-14(13)18/h4-7,12H,8-11H2,1-3H3,(H,19,22)

InChI key: InChIKey=NNZIQSXIPULPQV-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=CC=C1)N2CCC(NC(OC(C)(C)C)=O)CC2

Synonyms:

• 1,1-Dimethylethyl N-[1-(2-fluorobenzoyl)-4-piperidinyl]carbamate
• Carbamic acid, N-[1-(2-fluorobenzoyl)-4-piperidinyl]-, 1,1-dimethylethyl ester

tert-Butyl 1-(2-fluorobenzoyl)piperidin-4-ylcarbamate

CAS: 1286264-73-0

Formula: C₁₇H₂₃FN₂O₃

Purity: 95.0%

Molecular weight: 322.38

Ref: 10-F063915