CAS 1286265-17-5

1,1-Dimethylethyl 4-[[[(2-cyanophenyl)amino]carbonyl]amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[[[(2-cyanophenyl)amino]carbonyl]amino]-1-piperidinecarboxylate, identified by its CAS number 1286265-17-5, is a chemical compound characterized by its complex structure, which includes a piperidine ring and multiple functional groups. This compound features a dimethyl group attached to a carbon atom, contributing to its steric bulk, and a cyanophenyl moiety that introduces aromatic characteristics and potential reactivity. The presence of amino and carbonyl groups indicates that it may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Its molecular structure suggests potential applications in medicinal chemistry, possibly as a pharmaceutical intermediate or a bioactive compound. The compound's solubility, stability, and reactivity would depend on the specific conditions, including solvent and temperature. As with many organic compounds, safety data and handling precautions should be considered, particularly due to the presence of the cyanophenyl group, which may pose toxicity risks. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.

Formula: C₁₈H₂₄N₄O₃

InChI: InChI=1S/C18H24N4O3/c1-18(2,3)25-17(24)22-10-8-14(9-11-22)20-16(23)21-15-7-5-4-6-13(15)12-19/h4-7,14H,8-11H2,1-3H3,(H2,20,21,23)

InChI key: InChIKey=WMSATGNAUMRMJI-UHFFFAOYSA-N

SMILES: N(C(NC1CCN(C(OC(C)(C)C)=O)CC1)=O)C2=C(C#N)C=CC=C2

Synonyms:

• 1-Piperidinecarboxylic acid, 4-[[[(2-cyanophenyl)amino]carbonyl]amino]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[[[(2-cyanophenyl)amino]carbonyl]amino]-1-piperidinecarboxylate

tert-Butyl 4-[3-(2-cyanophenyl)ureido]piperidine-1-carboxylate

CAS: 1286265-17-5

Formula: C₁₈H₂₄N₄O₃

Purity: 95.0%

Molecular weight: 344.415

Ref: 10-F064163