CAS 1286265-31-3

Phenol, 2-[(4-amino-1-piperidinyl)methyl]-, hydrochloride (1:2)

Description:

Phenol, 2-[(4-amino-1-piperidinyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. The presence of a piperidine moiety indicates that it has a cyclic amine structure, contributing to its potential biological activity. The hydrochloride form suggests that the compound is a salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. This compound may exhibit properties such as antimicrobial or analgesic effects, typical of phenolic derivatives. Its molecular interactions are influenced by the amino group, which can participate in hydrogen bonding and affect its reactivity and biological interactions. The compound's stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity, especially in laboratory or industrial settings.

Formula: C₁₂H₁₉ClN₂O

InChI: InChI=1S/C12H18N2O.2ClH/c13-11-5-7-14(8-6-11)9-10-3-1-2-4-12(10)15;;/h1-4,11,15H,5-9,13H2;2*1H

InChI key: InChIKey=XMJUFMSNAKSBFL-UHFFFAOYSA-N

SMILES: C(C1=C(O)C=CC=C1)N2CCC(N)CC2.Cl

Synonyms:

• Phenol, 2-[(4-amino-1-piperidinyl)methyl]-, hydrochloride (1:2)
• 2-[(4-Aminopiperidin-1-yl)methyl]phenoldihydrochloride

2-[(4-Aminopiperidin-1-yl)methyl]phenoldihydrochloride

CAS: 1286265-31-3

Formula: C₁₂H₂₀Cl₂N₂O

Purity: 95.0%

Molecular weight: 279.21

Ref: 10-F064102