CymitQuimica logo

CAS 1286265-35-7

:

1,4-Cyclohexanediamine, N1-(3-pyridinylmethyl)-, hydrochloride (1:3), trans-

Description:
1,4-Cyclohexanediamine, N1-(3-pyridinylmethyl)-, hydrochloride (1:3), trans- is a chemical compound characterized by its structural features, which include a cyclohexane ring with two amine groups at the 1 and 4 positions, and a pyridinylmethyl substituent. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The trans configuration indicates that the substituents on the cyclohexane ring are positioned opposite each other, which can affect the compound's steric properties and reactivity. It is often studied for its potential applications in pharmaceuticals and materials science due to the presence of both amine and pyridine functional groups, which can participate in various chemical reactions and interactions. The compound's CAS number, 1286265-35-7, allows for precise identification in chemical databases. Overall, this substance exhibits characteristics typical of diamines and pyridine derivatives, making it of interest in various chemical and biological contexts.
Formula:C12H19N3·3ClH
InChI:InChI=1/C12H19N3.3ClH/c13-11-3-5-12(6-4-11)15-9-10-2-1-7-14-8-10;;;/h1-2,7-8,11-12,15H,3-6,9,13H2;3*1H/t11-,12-;;;
InChI key:InChIKey=SRYXCNZRTCLXTP-SUDWWZSHNA-N
SMILES:N(CC=1C=CC=NC1)[C@H]2CC[C@H](N)CC2.Cl
Synonyms:
  • 1,4-Cyclohexanediamine, N1-(3-pyridinylmethyl)-, hydrochloride (1:3), trans-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.