CAS 1286265-79-9

Methanone, [4-(aminomethyl)-1-piperidinyl]-4-pyridinyl-, hydrochloride (1:2)

Description:

Methanone, [4-(aminomethyl)-1-piperidinyl]-4-pyridinyl-, hydrochloride (1:2), identified by CAS number 1286265-79-9, is a chemical compound characterized by its complex structure that includes a piperidine ring and a pyridine moiety. This compound typically exhibits properties associated with both amines and ketones, which may influence its reactivity and interactions in biological systems. As a hydrochloride salt, it is likely to be soluble in water, enhancing its bioavailability for pharmaceutical applications. The presence of the aminomethyl group suggests potential for hydrogen bonding and interaction with biological targets, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and spectral data, would be essential for further understanding its behavior in various environments. Additionally, the compound may exhibit pharmacological properties, which would require thorough investigation through in vitro and in vivo studies to ascertain its efficacy and safety profile. Overall, this compound represents a significant area of interest for research and development in drug discovery.

Formula: C₁₂H₁₇N₃O·2ClH

InChI: InChI=1S/C12H17N3O.2ClH/c13-9-10-3-7-15(8-4-10)12(16)11-1-5-14-6-2-11;;/h1-2,5-6,10H,3-4,7-9,13H2;2*1H

InChI key: InChIKey=HXLUHOADMRFJHJ-UHFFFAOYSA-N

SMILES: C(=O)(N1CCC(CN)CC1)C=2C=CN=CC2.Cl

Synonyms:

• Methanone, [4-(aminomethyl)-1-piperidinyl]-4-pyridinyl-, hydrochloride (1:2)

[4-(Aminomethyl)piperidin-1-yl](pyridin-4-yl)methanone dihydrochloride

CAS: 1286265-79-9

Formula: C₁₂H₁₉Cl₂N₃O

Purity: 95.0%

Molecular weight: 292.2

Ref: 10-F064279