CAS 1286266-04-3

Phenol, 4-[(4-amino-1-piperidinyl)methyl]-, hydrochloride (1:2)

Description:

Phenol, 4-[(4-amino-1-piperidinyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. The presence of a piperidine moiety indicates that it has a nitrogen-containing cyclic structure, contributing to its potential biological activity. The hydrochloride form suggests that the compound is a salt, which typically enhances its solubility in water and may influence its pharmacokinetic properties. This compound may exhibit properties such as antimicrobial or analgesic effects, common to many phenolic derivatives. Its molecular interactions can be influenced by the amino group, which can participate in hydrogen bonding and affect the compound's reactivity and stability. The specific characteristics, such as melting point, solubility, and biological activity, would depend on the compound's detailed molecular structure and the conditions under which it is studied. As with many chemical substances, safety data and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₁₂H₁₈N₂O·2ClH

InChI: InChI=1S/C12H18N2O.2ClH/c13-11-5-7-14(8-6-11)9-10-1-3-12(15)4-2-10;;/h1-4,11,15H,5-9,13H2;2*1H

InChI key: InChIKey=UTWBERDEHDCXDP-UHFFFAOYSA-N

SMILES: C(C1=CC=C(O)C=C1)N2CCC(N)CC2.Cl

Synonyms:

• Phenol, 4-[(4-amino-1-piperidinyl)methyl]-, hydrochloride (1:2)

4-[(4-Aminopiperidin-1-yl)methyl]phenoldihydrochloride

CAS: 1286266-04-3

Formula: C₁₂H₂₀Cl₂N₂O

Purity: 95.0%

Molecular weight: 279.21

Ref: 10-F064104