CAS 1286272-70-5

4-Piperidinamine, 1-[(3-fluoro-2-methylphenyl)methyl]-, hydrochloride (1:2)

Description:

4-Piperidinamine, 1-[(3-fluoro-2-methylphenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a substituted phenyl group, specifically a 3-fluoro-2-methylphenyl moiety, indicating the presence of a fluorine atom and a methyl group on the aromatic ring. The hydrochloride form suggests that the compound is a salt, enhancing its solubility in water and making it suitable for various applications, including pharmaceutical formulations. The presence of the amine functional group indicates potential basicity and reactivity, which may contribute to its biological activity. As a hydrochloride salt, it typically exhibits improved stability and handling properties compared to its free base form. This compound may be of interest in medicinal chemistry, particularly in the development of therapeutic agents, due to its structural features that could interact with biological targets. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₃H₂₀ClFN₂

InChI: InChI=1S/C13H19FN2.2ClH/c1-10-11(3-2-4-13(10)14)9-16-7-5-12(15)6-8-16;;/h2-4,12H,5-9,15H2,1H3;2*1H

InChI key: InChIKey=FBJMQCCJMZWKGM-UHFFFAOYSA-N

SMILES: C(C1=C(C)C(F)=CC=C1)N2CCC(N)CC2.Cl

Synonyms:

• 4-Piperidinamine, 1-[(3-fluoro-2-methylphenyl)methyl]-, hydrochloride (1:2)
• 1-(3-Fluoro-2-methylbenzyl)piperidin-4-amine dihydrochloride

1-(3-Fluoro-2-methylbenzyl)piperidin-4-amine dihydrochloride

CAS: 1286272-70-5

Formula: C₁₃H₂₁Cl₂FN₂

Purity: 95.0%

Molecular weight: 295.22

Ref: 10-F064064