CAS 1286272-73-8

Benzamide, 2-cyano-N-4-piperidinyl-, hydrochloride (1:1)

Description:

Benzamide, 2-cyano-N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its benzamide structure, which features a cyano group and a piperidine moiety. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form. It is often studied for its potential pharmacological properties, particularly in the context of medicinal chemistry, where modifications to the benzamide structure can influence biological activity. The presence of the cyano group may enhance lipophilicity and affect the compound's interaction with biological targets. As with many chemical substances, safety data should be consulted, as it may pose risks such as irritation or toxicity depending on exposure levels. Proper handling and storage conditions are essential to ensure stability and safety. Overall, this compound represents a class of benzamide derivatives that are of interest in various research fields, including drug development and synthetic chemistry.

Formula: C₁₃H₁₅N₃O.ClH

InChI: InChI=1S/C13H15N3O.ClH/c14-9-10-3-1-2-4-12(10)13(17)16-11-5-7-15-8-6-11;/h1-4,11,15H,5-8H2,(H,16,17);1H

InChI key: InChIKey=WIFYNRCJJOBZHO-UHFFFAOYSA-N

SMILES: C(NC1CCNCC1)(=O)C2=C(C#N)C=CC=C2.Cl

2-Cyano-N-piperidin-4-yl-benzamide hydrochloride

CAS: 1286272-73-8

Formula: C₁₃H₁₆ClN₃O

Purity: 95.0%

Molecular weight: 265.74

Ref: 10-F064139