CAS 1286272-76-1

Benzoic acid, 2-[(4-amino-1-piperidinyl)methyl]-, methyl ester, hydrochloride (1:2)

Description:

Benzoic acid, 2-[(4-amino-1-piperidinyl)methyl]-, methyl ester, hydrochloride (1:2) is a chemical compound characterized by its structure, which includes a benzoic acid moiety, a piperidine ring, and a methyl ester functional group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological properties. The presence of the amino group on the piperidine ring suggests potential biological activity, possibly as a pharmaceutical agent. The methyl ester group indicates that it may undergo hydrolysis to release benzoic acid, which is known for its antimicrobial properties. The compound's molecular interactions may be influenced by the piperidine's basicity and the overall polarity of the molecule. As with many compounds containing amine and carboxylic acid functionalities, it may exhibit both acidic and basic properties, making it relevant in various chemical and biological contexts. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₄H₂₀N₂O₂·2ClH

InChI: InChI=1S/C14H20N2O2.2ClH/c1-18-14(17)13-5-3-2-4-11(13)10-16-8-6-12(15)7-9-16;;/h2-5,12H,6-10,15H2,1H3;2*1H

InChI key: InChIKey=RPYUGSAOKHDFCF-UHFFFAOYSA-N

SMILES: C(C1=C(C(OC)=O)C=CC=C1)N2CCC(N)CC2.Cl

Synonyms:

• Benzoic acid, 2-[(4-amino-1-piperidinyl)methyl]-, methyl ester, hydrochloride (1:2)

Methyl 2-[(4-aminopiperidin-1-yl)methyl]benzoate dihydrochloride

CAS: 1286272-76-1

Formula: C₁₄H₂₂Cl₂N₂O₂

Purity: 95.0%

Molecular weight: 321.24

Ref: 10-F064151