CymitQuimica logo

CAS 1286272-77-2

:

1,4-Cyclohexanediamine, N1-cyclohexyl-, hydrochloride (1:2), trans-

Description:
1,4-Cyclohexanediamine, N1-cyclohexyl-, hydrochloride (1:2), trans- is a chemical compound characterized by its cyclic structure and the presence of two amine functional groups. It is a derivative of cyclohexanediamine, where one of the amine groups is substituted with a cyclohexyl group, enhancing its hydrophobic properties. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which typically increases its solubility in water and may influence its stability and reactivity. This compound is likely to exhibit basic properties due to the presence of amine groups, making it a potential candidate for various applications in organic synthesis, pharmaceuticals, or as a building block in polymer chemistry. The trans configuration suggests that the substituents on the cyclohexane ring are oriented in a specific spatial arrangement, which can affect the compound's physical and chemical properties, including its melting point and solubility. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C12H24N2·2ClH
InChI:InChI=1/C12H24N2.2ClH/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11;;/h10-12,14H,1-9,13H2;2*1H/t10-,12-;;
InChI key:InChIKey=PBOSKTOMUCTGPT-HQOSNDRMNA-N
SMILES:N([C@H]1CC[C@H](N)CC1)C2CCCCC2.Cl
Synonyms:
  • 1,4-Cyclohexanediamine, N1-cyclohexyl-, hydrochloride (1:2), trans-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.