CAS 1286272-94-3

Methanone, [4-(aminomethyl)-1-piperidinyl](4-fluorophenyl)-, hydrochloride (1:1)

Description:

Methanone, [4-(aminomethyl)-1-piperidinyl](4-fluorophenyl)-, hydrochloride (1:1), identified by CAS number 1286272-94-3, is a chemical compound characterized by its piperidine structure, which includes an aminomethyl group and a fluorophenyl moiety. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous solutions, which is crucial for biological and pharmaceutical applications. The presence of the fluorine atom in the phenyl ring can influence the compound's electronic properties, potentially affecting its reactivity and biological activity. Methanone derivatives often exhibit significant pharmacological properties, making them of interest in medicinal chemistry. The piperidine ring contributes to the compound's ability to interact with biological targets, such as receptors or enzymes. Overall, this compound's unique structural features suggest potential utility in drug development, particularly in areas requiring modulation of neurotransmitter systems or other biological pathways. However, specific biological activity and safety profiles would require further investigation through empirical studies.

Formula: C₁₃H₁₇FN₂O·ClH

InChI: InChI=1S/C13H17FN2O.ClH/c14-12-3-1-11(2-4-12)13(17)16-7-5-10(9-15)6-8-16;/h1-4,10H,5-9,15H2;1H

InChI key: InChIKey=KMPPYKGWOMKUBK-UHFFFAOYSA-N

SMILES: C(=O)(N1CCC(CN)CC1)C2=CC=C(F)C=C2.Cl

Synonyms:

• Methanone, [4-(aminomethyl)-1-piperidinyl](4-fluorophenyl)-, hydrochloride (1:1)

[4-(Aminomethyl)piperidin-1-yl](4-fluorophenyl)methanone hydrochloride

CAS: 1286272-94-3

Formula: C₁₃H₁₈ClFN₂O

Purity: 95.0%

Molecular weight: 272.75

Ref: 10-F064281