CymitQuimica logo

CAS 1286272-97-6

:

1,4-Cyclohexanediamine, N<sup>1</sup>-(cyclobutylmethyl)-, hydrochloride (1:2), trans-

Description:
1,4-Cyclohexanediamine, N^1-(cyclobutylmethyl)-, hydrochloride (1:2), trans- is a chemical compound characterized by its cyclic structure and the presence of amine functional groups. It features a cyclohexane ring with two amine groups at the 1 and 4 positions, which contributes to its potential as a building block in organic synthesis and pharmaceuticals. The addition of a cyclobutylmethyl group enhances its steric and electronic properties, potentially influencing its reactivity and interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in various applications, including drug formulation. The trans configuration indicates the specific spatial arrangement of substituents around the cyclohexane ring, which can affect the compound's physical and chemical properties, such as melting point and boiling point. Overall, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and material science.
Formula:C11H22N2·2ClH
InChI:InChI=1/C11H22N2.2ClH/c12-10-4-6-11(7-5-10)13-8-9-2-1-3-9;;/h9-11,13H,1-8,12H2;2*1H/t10-,11-;;
InChI key:InChIKey=NXEODXWEYDROEK-SOBFFWEGNA-N
SMILES:N(CC1CCC1)[C@H]2CC[C@H](N)CC2.Cl
Synonyms:
  • 1,4-Cyclohexanediamine, N1-(cyclobutylmethyl)-, hydrochloride (1:2), trans-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.