CAS 1286273-01-5
:1,1-Dimethylethyl N-[trans-4-[[(3-cyanophenyl)methyl]amino]cyclohexyl]carbamate
Description:
1,1-Dimethylethyl N-[trans-4-[[(3-cyanophenyl)methyl]amino]cyclohexyl]carbamate, identified by its CAS number 1286273-01-5, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by a dimethyl group attached to a tert-butyl moiety, which contributes to its steric bulk. The presence of a cyclohexyl group and a cyanophenyl moiety indicates potential for diverse interactions, making it of interest in medicinal chemistry and pharmacology. The compound may exhibit specific biological activities due to its unique functional groups, which can influence its solubility, stability, and reactivity. Additionally, the trans configuration of the cyclohexyl derivative suggests a particular spatial arrangement that could affect its binding affinity to biological targets. As with many carbamates, it may also be subject to hydrolysis under certain conditions, leading to the release of amines and alcohols. Overall, this compound's structural features suggest potential applications in drug development, although further studies would be necessary to elucidate its specific properties and biological effects.
Formula:C19H27N3O2
InChI:InChI=1/C19H27N3O2/c1-19(2,3)24-18(23)22-17-9-7-16(8-10-17)21-13-15-6-4-5-14(11-15)12-20/h4-6,11,16-17,21H,7-10,13H2,1-3H3,(H,22,23)/t16-,17-
InChI key:InChIKey=XBDOKNWCBLNDLW-QAQDUYKDNA-N
SMILES:N(CC1=CC(C#N)=CC=C1)[C@H]2CC[C@H](NC(OC(C)(C)C)=O)CC2
Synonyms:- Carbamic acid, N-[trans-4-[[(3-cyanophenyl)methyl]amino]cyclohexyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[trans-4-[[(3-cyanophenyl)methyl]amino]cyclohexyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl (1R*,4R*)-4-(3-cyanobenzylamino)cyclohexylcarbamate
CAS:Formula:C19H27N3O2Molecular weight:329.444
