CAS 1286273-03-7

1-Piperidinecarboxamide, 4-amino-N-(1-methylethyl)-, hydrochloride (1:1)

Description:

1-Piperidinecarboxamide, 4-amino-N-(1-methylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a carboxamide functional group, indicating the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N). The "4-amino" designation suggests that there is an amino group (-NH2) attached to the fourth carbon of the piperidine ring, while the "N-(1-methylethyl)" indicates a branched alkyl group attached to the nitrogen of the amide. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. The compound may exhibit biological activity, potentially influencing various physiological processes, making it of interest in medicinal chemistry. Its specific properties, such as melting point, solubility, and stability, would depend on the conditions under which it is handled and stored.

Formula: C₉H₁₉N₃O·ClH

InChI: InChI=1S/C9H19N3O.ClH/c1-7(2)11-9(13)12-5-3-8(10)4-6-12;/h7-8H,3-6,10H2,1-2H3,(H,11,13);1H

InChI key: InChIKey=VXQAKTPJWSQRSE-UHFFFAOYSA-N

SMILES: C(NC(C)C)(=O)N1CCC(N)CC1.Cl

Synonyms:

• 1-Piperidinecarboxamide, 4-amino-N-(1-methylethyl)-, hydrochloride (1:1)

4-Amino-N-isopropylpiperidine-1-carboxamide hydrochloride

CAS: 1286273-03-7

Formula: C₉H₂₀ClN₃O

Purity: 95.0%

Molecular weight: 221.73

Ref: 10-F064037

4-Amino-N-isopropylpiperidine-1-carboxamide Hydrochloride

Controlled Product

CAS: 1286273-03-7

Formula: C₉H₁₉N₃O·HCl

Color and Shape: Neat

Molecular weight: 221.728

Ref: TR-A406510