CAS 1286273-09-3

4-Piperidinemethanamine, 1-[(4-chlorophenyl)methyl]-, hydrochloride (1:2)

Description:

4-Piperidinemethanamine, 1-[(4-chlorophenyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential for forming salts, such as the hydrochloride form. This compound features a 4-chlorobenzyl group, which enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals. The presence of the piperidine moiety suggests potential interactions with neurotransmitter systems, making it of interest in medicinal chemistry. Its molecular structure indicates that it may exhibit properties such as being a potential ligand for certain receptors or enzymes. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound's unique structural features and properties make it a subject of interest in research and development within the fields of chemistry and pharmacology.

Formula: C₁₃H₁₉ClN₂·2ClH

InChI: InChI=1S/C13H19ClN2.2ClH/c14-13-3-1-12(2-4-13)10-16-7-5-11(9-15)6-8-16;;/h1-4,11H,5-10,15H2;2*1H

InChI key: InChIKey=VFPFSYYQHQUQLW-UHFFFAOYSA-N

SMILES: C(N1CCC(CN)CC1)C2=CC=C(Cl)C=C2.Cl

Synonyms:

• 4-Piperidinemethanamine, 1-[(4-chlorophenyl)methyl]-, hydrochloride (1:2)

[1-(4-Chlorobenzyl)piperidin-4-yl]methanamine dihydrochloride

CAS: 1286273-09-3

Formula: C₁₃H₂₁Cl₃N₂

Purity: 95.0%

Molecular weight: 311.68

Ref: 10-F064333