CAS 1286273-11-7

4-Piperidinemethanamine, 1-(ethylsulfonyl)-, hydrochloride (1:1)

Description:

4-Piperidinemethanamine, 1-(ethylsulfonyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features an ethylsulfonyl group, which contributes to its solubility and reactivity. As a hydrochloride salt, it is typically encountered in a crystalline form, enhancing its stability and ease of handling in various applications. The presence of the sulfonyl group may impart unique properties, such as increased polarity and potential for hydrogen bonding, which can influence its biological activity and interactions with other molecules. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting neurological or psychiatric conditions, given the piperidine moiety's prevalence in medicinal chemistry. Safety and handling precautions are essential, as with any chemical substance, to mitigate risks associated with its use. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications.

Formula: C₈H₁₈N₂O₂S·ClH

InChI: InChI=1S/C8H18N2O2S.ClH/c1-2-13(11,12)10-5-3-8(7-9)4-6-10;/h8H,2-7,9H2,1H3;1H

InChI key: InChIKey=HGXPPAJPOFLRFC-UHFFFAOYSA-N

SMILES: S(CC)(=O)(=O)N1CCC(CN)CC1.Cl

Synonyms:

• [1-(Ethylsulfonyl)piperidin-4-yl]methanamine hydrochloride
• 4-Piperidinemethanamine, 1-(ethylsulfonyl)-, hydrochloride (1:1)
• [1-(Ethanesulfonyl)piperidin-4-yl]methanamine hydrochloride

[1-(Ethylsulfonyl)piperidin-4-yl]methanamine hydrochloride

CAS: 1286273-11-7

Formula: C₈H₁₉ClN₂O₂S

Purity: 95.0%

Molecular weight: 242.76

Ref: 10-F064340

[1-(Ethanesulfonyl)piperidin-4-yl]methanamine hydrochloride

CAS: 1286273-11-7

Versatile small molecule scaffold

Formula: C₈H₁₉ClN₂O₂S

Purity: Min. 95%

Molecular weight: 242.77 g/mol

Ref: 3D-LBC27311