CAS 1286273-13-9

1,1-Dimethylethyl N-[[1-(tetrahydro-2H-pyran-4-yl)-4-piperidinyl]methyl]carbamate

Description:

1,1-Dimethylethyl N-[[1-(tetrahydro-2H-pyran-4-yl)-4-piperidinyl]methyl]carbamate, identified by its CAS number 1286273-13-9, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a piperidine ring. This compound features a dimethyl group attached to a tert-butyl moiety, contributing to its steric bulk. The presence of the tetrahydro-2H-pyran ring adds to its cyclic structure, which can influence its reactivity and interaction with biological systems. The piperidine component is known for its role in various pharmacological activities, making this compound of interest in medicinal chemistry. Its solubility, stability, and potential biological activity would depend on the specific conditions and the presence of other functional groups. Overall, this compound's unique structure suggests potential applications in drug development or as a biochemical tool, although specific properties such as melting point, boiling point, and solubility would require empirical measurement for precise characterization.

Formula: C₁₆H₃₀N₂O₃

InChI: InChI=1S/C16H30N2O3/c1-16(2,3)21-15(19)17-12-13-4-8-18(9-5-13)14-6-10-20-11-7-14/h13-14H,4-12H2,1-3H3,(H,17,19)

InChI key: InChIKey=MAWYJNZAUNFJEL-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)C1CCN(CC1)C2CCOCC2

Synonyms:

• Carbamic acid, N-[[1-(tetrahydro-2H-pyran-4-yl)-4-piperidinyl]methyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[[1-(tetrahydro-2H-pyran-4-yl)-4-piperidinyl]methyl]carbamate

tert-Butyl [1-(tetrahydro-2H-pyran-4-yl)piperidin-4-yl]methylcarbamate

CAS: 1286273-13-9

Formula: C₁₆H₃₀N₂O₃

Purity: 95.0%

Molecular weight: 298.427

Ref: 10-F064350