CAS 1286273-15-1

Benzamide, N-(trans-4-aminocyclohexyl)-2-fluoro-, hydrochloride (1:1)

Description:

Benzamide, N-(trans-4-aminocyclohexyl)-2-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its benzamide structure, which features a benzene ring attached to a carbonyl group (C=O) and an amine group. The presence of the trans-4-aminocyclohexyl moiety indicates that the compound has a cyclohexane ring with an amino group positioned in a trans configuration relative to the benzamide group. The addition of a fluorine atom at the 2-position of the benzamide enhances its chemical properties, potentially influencing its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in various applications, including pharmaceuticals. The compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 1286273-15-1, allows for precise identification in chemical databases. Overall, this compound's unique structural features contribute to its potential utility in research and therapeutic contexts.

Formula: C₁₃H₁₇FN₂O·ClH

InChI: InChI=1/C13H17FN2O.ClH/c14-12-4-2-1-3-11(12)13(17)16-10-7-5-9(15)6-8-10;/h1-4,9-10H,5-8,15H2,(H,16,17);1H/t9-,10-;

InChI key: InChIKey=RBNGOZPYRDOWGV-AWLKUTLJNA-N

SMILES: C(N[C@H]1CC[C@H](N)CC1)(=O)C2=C(F)C=CC=C2.Cl

Synonyms:

• Benzamide, N-(trans-4-aminocyclohexyl)-2-fluoro-, hydrochloride (1:1)

N-[(1R*,4R*)-4-Aminocyclohexyl]-2-fluorobenzamide hydrochloride

CAS: 1286273-15-1

Formula: C₁₃H₁₈ClFN₂O

Molecular weight: 272.75

Ref: 10-F097569