CAS 1286273-20-8

1,1-Dimethylethyl N-[[1-(cyclopentylmethyl)-4-piperidinyl]methyl]carbamate

Description:

1,1-Dimethylethyl N-[[1-(cyclopentylmethyl)-4-piperidinyl]methyl]carbamate, identified by its CAS number 1286273-20-8, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by the presence of a dimethyl group, a piperidine ring, and a cyclopentylmethyl substituent. Its molecular architecture suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The compound is likely to exhibit moderate to high lipophilicity, which can influence its bioavailability and pharmacokinetic properties. Additionally, the presence of the carbamate functional group may impart specific reactivity and stability characteristics, making it a candidate for further investigation in drug design. Safety and handling considerations are essential, as with many organic compounds, to mitigate any potential hazards associated with exposure. Overall, this compound represents a unique structure that may offer interesting properties for research and application in various fields.

Formula: C₁₇H₃₂N₂O₂

InChI: InChI=1S/C17H32N2O2/c1-17(2,3)21-16(20)18-12-14-8-10-19(11-9-14)13-15-6-4-5-7-15/h14-15H,4-13H2,1-3H3,(H,18,20)

InChI key: InChIKey=VLCMDCOFAPUDLE-UHFFFAOYSA-N

SMILES: C(N1CCC(CNC(OC(C)(C)C)=O)CC1)C2CCCC2

Synonyms:

• Carbamic acid, N-[[1-(cyclopentylmethyl)-4-piperidinyl]methyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[[1-(cyclopentylmethyl)-4-piperidinyl]methyl]carbamate
• tert-Butyl [1-(cyclopentylmethyl)piperidin-4-yl]methylcarbamate

tert-Butyl [1-(cyclopentylmethyl)piperidin-4-yl]methylcarbamate

CAS: 1286273-20-8

Formula: C₁₇H₃₂N₂O₂

Purity: 95.0%

Molecular weight: 296.455

Ref: 10-F064348