CAS 1286273-23-1

1,1-Dimethylethyl N-[trans-4-(benzoylamino)cyclohexyl]carbamate

Description:

1,1-Dimethylethyl N-[trans-4-(benzoylamino)cyclohexyl]carbamate, identified by its CAS number 1286273-23-1, is a chemical compound characterized by its unique structural features. It contains a carbamate functional group, which is indicative of its potential applications in medicinal chemistry and agrochemicals. The presence of the dimethyl group suggests steric hindrance, which may influence its reactivity and interaction with biological targets. The trans-4-benzoylamino-cyclohexyl moiety contributes to its molecular complexity and may enhance its binding affinity to specific receptors or enzymes. This compound is likely to exhibit moderate solubility in organic solvents, while its solubility in water may be limited due to the hydrophobic characteristics of the cyclohexyl and benzoyl groups. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, the unique combination of functional groups in this compound suggests potential utility in various chemical and pharmaceutical applications, warranting further investigation into its properties and effects.

Formula: C₁₈H₂₆N₂O₃

InChI: InChI=1/C18H26N2O3/c1-18(2,3)23-17(22)20-15-11-9-14(10-12-15)19-16(21)13-7-5-4-6-8-13/h4-8,14-15H,9-12H2,1-3H3,(H,19,21)(H,20,22)/t14-,15-

InChI key: InChIKey=HPYCMUIBVMZAKS-SHTZXODSNA-N

SMILES: C(N[C@H]1CC[C@H](NC(OC(C)(C)C)=O)CC1)(=O)C2=CC=CC=C2

Synonyms:

• Carbamic acid, N-[trans-4-(benzoylamino)cyclohexyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[trans-4-(benzoylamino)cyclohexyl]carbamate

tert-Butyl (1R*,4R*)-4-benzamidocyclohexylcarbamate

CAS: 1286273-23-1

Formula: C₁₈H₂₆N₂O₃

Molecular weight: 318.417

Ref: 10-F097549