
CAS 1286273-51-5
:Propanamide, N-(trans-4-aminocyclohexyl)-2-methyl-, hydrochloride (1:1)
Description:
Propanamide, N-(trans-4-aminocyclohexyl)-2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from propanoic acid. The presence of the trans-4-aminocyclohexyl group indicates a cyclohexane ring with an amino group positioned in a trans configuration, contributing to its stereochemical properties. The compound is a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological properties. Typically, compounds of this nature are studied for their potential biological activities, including their role as intermediates in pharmaceutical synthesis or as active pharmaceutical ingredients. The molecular structure suggests that it may exhibit specific interactions with biological targets, potentially leading to therapeutic applications. Additionally, the presence of the methyl group on the propanamide backbone may affect its lipophilicity and overall reactivity. As with many amides, it is expected to have moderate stability under physiological conditions, although specific reactivity and stability would depend on the surrounding environment and conditions.
Formula:C10H20N2O·ClH
InChI:InChI=1/C10H20N2O.ClH/c1-7(2)10(13)12-9-5-3-8(11)4-6-9;/h7-9H,3-6,11H2,1-2H3,(H,12,13);1H/t8-,9-;
InChI key:InChIKey=ONIIJOXTVVNIRE-JUAUBFSONA-N
SMILES:N(C(C(C)C)=O)[C@H]1CC[C@H](N)CC1.Cl
Synonyms:- Propanamide, N-(trans-4-aminocyclohexyl)-2-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
