
CAS 1286273-54-8
:6-Methyl-3-(4-morpholinyl)-2-pyridinamine
Description:
6-Methyl-3-(4-morpholinyl)-2-pyridinamine, identified by its CAS number 1286273-54-8, is a chemical compound characterized by its pyridine ring structure, which is substituted at the 2-position with an amino group and at the 6-position with a methyl group. The presence of a morpholine group at the 3-position contributes to its potential as a pharmacological agent, as morpholines are often associated with various biological activities. This compound may exhibit properties such as solubility in polar solvents, which is typical for amine-containing compounds, and it may participate in hydrogen bonding due to the amino and morpholine functionalities. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways. Additionally, the presence of both a heterocyclic ring and a morpholine moiety may influence its lipophilicity and bioavailability, making it a candidate for further investigation in drug development.
Formula:C10H15N3O
InChI:InChI=1S/C10H15N3O/c1-8-2-3-9(10(11)12-8)13-4-6-14-7-5-13/h2-3H,4-7H2,1H3,(H2,11,12)
InChI key:InChIKey=ILKZZXMKWBIRRU-UHFFFAOYSA-N
SMILES:NC1=C(N2CCOCC2)C=CC(C)=N1
Synonyms:- 6-Methyl-3-(4-morpholinyl)-2-pyridinamine
- 2-Pyridinamine, 6-methyl-3-(4-morpholinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.