CAS 1286273-94-6

4-Piperidinemethanamine, 1-(cyclopentylmethyl)-, hydrochloride (1:2)

Description:

4-Piperidinemethanamine, 1-(cyclopentylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential as a pharmacological agent. The presence of the cyclopentylmethyl group enhances its lipophilicity, potentially influencing its ability to cross biological membranes. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for formulation in pharmaceutical applications. This compound may exhibit various biological activities, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular structure suggests potential interactions with neurotransmitter systems, although specific biological effects would depend on further empirical studies. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, 4-Piperidinemethanamine, 1-(cyclopentylmethyl)-, hydrochloride (1:2) represents a class of compounds that may have significant implications in drug discovery and development.

Formula: C₁₂H₂₄N₂·2ClH

InChI: InChI=1S/C12H24N2.2ClH/c13-9-11-5-7-14(8-6-11)10-12-3-1-2-4-12;;/h11-12H,1-10,13H2;2*1H

InChI key: InChIKey=AZZWIPRNIRXOFX-UHFFFAOYSA-N

SMILES: C(N1CCC(CN)CC1)C2CCCC2.Cl

Synonyms:

• 4-Piperidinemethanamine, 1-(cyclopentylmethyl)-, hydrochloride (1:2)

[1-(Cyclopentylmethyl)piperidin-4-yl]methanamine dihydrochloride

CAS: 1286273-94-6

Formula: C₁₂H₂₆Cl₂N₂

Purity: 95.0%

Molecular weight: 269.25

Ref: 10-F064324