CAS 1286273-96-8

Benzonitrile, 2-[(4-amino-1-piperidinyl)carbonyl]-, hydrochloride (1:1)

Description:

Benzonitrile, 2-[(4-amino-1-piperidinyl)carbonyl]-, hydrochloride (1:1) is a chemical compound characterized by its structural components, which include a benzonitrile moiety and a piperidine ring with an amino group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and methanol, owing to the presence of the hydrochloride salt form. The presence of the amino group suggests potential basicity, while the benzonitrile structure contributes to its aromatic characteristics. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. Its hydrochloride form enhances stability and solubility, which are critical for drug formulation. As with many chemical substances, handling should be conducted with care, adhering to safety protocols to mitigate any potential hazards associated with its use. Overall, this compound represents a unique combination of functional groups that may impart specific chemical and biological properties.

Formula: C₁₃H₁₅N₃O·ClH

InChI: InChI=1S/C13H15N3O.ClH/c14-9-10-3-1-2-4-12(10)13(17)16-7-5-11(15)6-8-16;/h1-4,11H,5-8,15H2;1H

InChI key: InChIKey=MWZVYAQVBSVQRL-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C#N)C=CC=C1)N2CCC(N)CC2.Cl

Synonyms:

• Benzonitrile, 2-[(4-amino-1-piperidinyl)carbonyl]-, hydrochloride (1:1)

2-(4-Aminopiperidine-1-carbonyl)benzonitrile hydrochloride

CAS: 1286273-96-8

Formula: C₁₃H₁₆ClN₃O

Purity: 95.0%

Molecular weight: 265.74

Ref: 10-F064197