CAS 1286273-98-0

2-Butanone, 1-(4-amino-1-piperidinyl)-3,3-dimethyl-, hydrochloride (1:2)

Description:

2-Butanone, 1-(4-amino-1-piperidinyl)-3,3-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a butanone moiety and a piperidine ring substituted with an amino group. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in pharmaceutical and chemical research. The presence of the piperidine ring contributes to its potential biological activity, which may include interactions with neurotransmitter systems. The dimethyl substitution on the butanone backbone can influence its steric and electronic properties, affecting its reactivity and interaction with other molecules. As a hydrochloride salt, it is likely to exhibit improved stability and handling characteristics compared to its free base form. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry, particularly in the development of therapeutic agents targeting central nervous system disorders. However, specific safety and handling guidelines should be followed due to its chemical nature.

Formula: C₁₁H₂₂N₂O·2ClH

InChI: InChI=1S/C11H22N2O.2ClH/c1-11(2,3)10(14)8-13-6-4-9(12)5-7-13;;/h9H,4-8,12H2,1-3H3;2*1H

InChI key: InChIKey=UYOHPAYUAQDVPJ-UHFFFAOYSA-N

SMILES: C(C(C(C)(C)C)=O)N1CCC(N)CC1.Cl

Synonyms:

• 2-Butanone, 1-(4-amino-1-piperidinyl)-3,3-dimethyl-, hydrochloride (1:2)

1-(4-Aminopiperidin-1-yl)-3,3-dimethylbutan-2-one dihydrochloride

CAS: 1286273-98-0

Formula: C₁₁H₂₄Cl₂N₂O

Purity: 95.0%

Molecular weight: 271.23

Ref: 10-F064034