CAS 1286274-00-7

Benzonitrile, 4-[[(trans-4-aminocyclohexyl)amino]methyl]-, hydrochloride (1:2)

Description:

Benzonitrile, 4-[[(trans-4-aminocyclohexyl)amino]methyl]-, hydrochloride (1:2) is a chemical compound characterized by its structural features, which include a benzonitrile moiety and a cyclohexylamine derivative. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydrochloride salt form. The presence of the amino group suggests potential basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Its molecular structure indicates potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The compound's CAS number, 1286274-00-7, allows for precise identification in chemical databases. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound's unique characteristics make it of interest in both synthetic chemistry and medicinal applications.

Formula: C₁₄H₁₉N₃·2ClH

InChI: InChI=1/C14H19N3.2ClH/c15-9-11-1-3-12(4-2-11)10-17-14-7-5-13(16)6-8-14;;/h1-4,13-14,17H,5-8,10,16H2;2*1H/t13-,14-;;

InChI key: InChIKey=DRXYKJNRDOKMKI-MXPSUWBQNA-N

SMILES: C(N[C@H]1CC[C@H](N)CC1)C2=CC=C(C#N)C=C2.Cl

Synonyms:

• Benzonitrile, 4-[[(trans-4-aminocyclohexyl)amino]methyl]-, hydrochloride (1:2)

4-[(1R*,4R*)-4-Aminocyclohexylamino]methyl-benzonitrile dihydrochloride

CAS: 1286274-00-7

Formula: C₁₄H₂₁Cl₂N₃

Molecular weight: 302.24

Ref: 10-F097459