CAS 1286274-12-1

1,1-Dimethylethyl N-[trans-4-[[(2-chlorophenyl)methyl]amino]cyclohexyl]carbamate

Description:

1,1-Dimethylethyl N-[trans-4-[[(2-chlorophenyl)methyl]amino]cyclohexyl]carbamate, identified by its CAS number 1286274-12-1, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by a dimethyl group attached to a tert-butyl moiety, which contributes to its steric bulk. The presence of a cyclohexyl group and a chlorophenyl moiety indicates potential interactions with biological systems, making it of interest in pharmaceutical applications. The trans configuration of the cyclohexyl derivative suggests specific spatial arrangements that may influence its biological activity and receptor binding. Additionally, the compound's carbamate functional group is known for its reactivity and ability to form hydrogen bonds, which can enhance solubility and stability in various environments. Overall, this compound's unique structural features may contribute to its potential efficacy in therapeutic contexts, although specific biological activities and properties would require further investigation through empirical studies.

Formula: C₁₈H₂₇ClN₂O₂

InChI: InChI=1/C18H27ClN2O2/c1-18(2,3)23-17(22)21-15-10-8-14(9-11-15)20-12-13-6-4-5-7-16(13)19/h4-7,14-15,20H,8-12H2,1-3H3,(H,21,22)/t14-,15-

InChI key: InChIKey=GJARMCQNWKHIMO-SHTZXODSNA-N

SMILES: N(C(OC(C)(C)C)=O)[C@H]1CC[C@H](NCC2=C(Cl)C=CC=C2)CC1

Synonyms:

• Carbamic acid, N-[trans-4-[[(2-chlorophenyl)methyl]amino]cyclohexyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[trans-4-[[(2-chlorophenyl)methyl]amino]cyclohexyl]carbamate
• tert-Butyl (1R*,4R*)-4-(2-chlorobenzylamino)cyclohexylcarbamate
• TERT-BUTYL (TRANS-4-((2-CHLOROBENZYL)AMINO)CYCLOHEXYL)CARBAMATE

tert-Butyl (1R*,4R*)-4-(2-chlorobenzylamino)cyclohexylcarbamate

CAS: 1286274-12-1

Formula: C₁₈H₂₇ClN₂O₂

Molecular weight: 338.88

Ref: 10-F097458