CAS 1286274-16-5
:1,1-Dimethylethyl N-[trans-4-[(1-ethylpropyl)amino]cyclohexyl]carbamate
Description:
1,1-Dimethylethyl N-[trans-4-[(1-ethylpropyl)amino]cyclohexyl]carbamate, identified by its CAS number 1286274-16-5, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by a dimethyl group attached to a tert-butyl moiety, which contributes to its steric bulk. The presence of a cyclohexyl group and an ethylpropyl amino substituent indicates potential for significant steric interactions and possibly unique biological activity. Carbamates are known for their applications in various fields, including agriculture as pesticides and in pharmaceuticals. The specific arrangement of functional groups in this compound may influence its solubility, stability, and reactivity, making it of interest for further study in medicinal chemistry or agrochemical applications. Additionally, the trans configuration of the cyclohexyl derivative suggests specific spatial orientation that could affect its interaction with biological targets. Overall, this compound's unique structure may provide insights into its potential uses and mechanisms of action in various chemical contexts.
Formula:C16H32N2O2
InChI:InChI=1/C16H32N2O2/c1-6-12(7-2)17-13-8-10-14(11-9-13)18-15(19)20-16(3,4)5/h12-14,17H,6-11H2,1-5H3,(H,18,19)/t13-,14-
InChI key:InChIKey=ZLXWNJLYNFKZQV-HDJSIYSDNA-N
SMILES:N(C(CC)CC)[C@H]1CC[C@H](NC(OC(C)(C)C)=O)CC1
Synonyms:- 1,1-Dimethylethyl N-[trans-4-[(1-ethylpropyl)amino]cyclohexyl]carbamate
- Carbamic acid, N-[trans-4-[(1-ethylpropyl)amino]cyclohexyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
